C17H15BrN2S — CID 16682254
6,7-diphenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide (PubChem CID 16682254) has the molecular formula C17H15BrN2S and a molecular weight of 359.29 g/mol. Its IUPAC name is 6,7-diphenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide.
| Compound Name | 6,7-diphenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
|---|---|
| PubChem CID | 16682254 |
| Molecular Formula | C17H15BrN2S |
| Molecular Weight | 359.29 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 6,7-diphenyl-2,3-dihydroimidazo[2,1-b][1,3]thiazol-4-ium bromide |
| SMILES | [Br-].c1ccc(-c2c[n+]3c(n2-c2ccccc2)SCC3)cc1 |
| InChI | InChI=1S/C17H15N2S.BrH/c1-3-7-14(8-4-1)16-13-18-11-12-20-17(18)19(16)15-9-5-2-6-10-15;/h1-10,13H,11-12H2;1H/q+1;/p-1 |
| InChIKey | RBONHSSHAICNQY-UHFFFAOYSA-M |
| XLogP | 0.54 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.29 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|