About 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole
3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole (PubChem CID 166823071) has the molecular formula C16H21N
and a molecular weight of 227.35 g/mol. Its IUPAC name is 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole.
Molecular Properties
| Compound Name | 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole |
| PubChem CID | 166823071 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole |
| SMILES | C/C=C\c1c(CC)c2c(n1C)C=CCC(C)=C2 |
| InChI | InChI=1S/C16H21N/c1-5-8-15-13(6-2)14-11-12(3)9-7-10-16(14)17(15)4/h5,7-8,10-11H,6,9H2,1-4H3/b8-5- |
| InChIKey | MGSBVDRHRDUVHS-YVMONPNESA-N |
| XLogP | 4.44 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole?
The IUPAC name of 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole (CID 166823071) is 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole.
What is the SMILES notation for 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole?
The canonical SMILES for 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole is C/C=C\c1c(CC)c2c(n1C)C=CCC(C)=C2.
What is the InChIKey of 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole?
The InChIKey is MGSBVDRHRDUVHS-YVMONPNESA-N. The full InChI is InChI=1S/C16H21N/c1-5-8-15-13(6-2)14-11-12(3)9-7-10-16(14)17(15)4/h5,7-8,10-11H,6,9H2,1-4H3/b8-5-.
What are the key properties of 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole?
3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole has a molecular weight of 227.35 g/mol, XLogP of 4.44, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,5-dimethyl-2-[(Z)-prop-1-enyl]-6H-cyclohepta[b]pyrrole is sourced from PubChem (CID 166823071), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).