About 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride
4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride (PubChem CID 16682316) has the molecular formula C21H24ClNO
and a molecular weight of 341.88 g/mol. Its IUPAC name is 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride.
Molecular Properties
| Compound Name | 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride |
| PubChem CID | 16682316 |
| Molecular Formula | C21H24ClNO |
| Molecular Weight | 341.88 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride |
| SMILES | CC1CCCN1CC#CC(O)(c1ccccc1)c1ccccc1.Cl |
| InChI | InChI=1S/C21H23NO.ClH/c1-18-10-8-16-22(18)17-9-15-21(23,19-11-4-2-5-12-19)20-13-6-3-7-14-20;/h2-7,11-14,18,23H,8,10,16-17H2,1H3;1H |
| InChIKey | GCXVQEDSLYNMPY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.88 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride?
The IUPAC name of 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride (CID 16682316) is 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride.
What is the SMILES notation for 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride?
The canonical SMILES for 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride is CC1CCCN1CC#CC(O)(c1ccccc1)c1ccccc1.Cl.
What is the InChIKey of 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride?
The InChIKey is GCXVQEDSLYNMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23NO.ClH/c1-18-10-8-16-22(18)17-9-15-21(23,19-11-4-2-5-12-19)20-13-6-3-7-14-20;/h2-7,11-14,18,23H,8,10,16-17H2,1H3;1H.
What are the key properties of 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride?
4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride has a molecular weight of 341.88 g/mol, XLogP of 3.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-methylpyrrolidin-1-yl)-1,1-diphenylbut-2-yn-1-ol;hydrochloride is sourced from PubChem (CID 16682316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).