C30H43N5O4S — CID 166823471
1-[2-(6-formamidohexanoylamino)-3,3-dimethylbutanoyl]-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide (PubChem CID 166823471) has the molecular formula C30H43N5O4S and a molecular weight of 569.77 g/mol. Its IUPAC name is 1-[2-(6-formamidohexanoylamino)-3,3-dimethylbutanoyl]-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[2-(6-formamidohexanoylamino)-3,3-dimethylbutanoyl]-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166823471 |
| Molecular Formula | C30H43N5O4S |
| Molecular Weight | 569.77 g/mol |
| Exact Mass | 569.30 |
| IUPAC Name | 1-[2-(6-formamidohexanoylamino)-3,3-dimethylbutanoyl]-N-[1-[4-(4-methyl-1,3-thiazol-5-yl)phenyl]ethyl]pyrrolidine-2-carboxamide |
| SMILES | Cc1ncsc1-c1ccc(C(C)NC(=O)C2CCCN2C(=O)C(NC(=O)CCCCCNC=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C30H43N5O4S/c1-20(22-12-14-23(15-13-22)26-21(2)32-19-40-26)33-28(38)24-10-9-17-35(24)29(39)27(30(3,4)5)34-25(37)11-7-6-8-16-31-18-36/h12-15,18-20,24,27H,6-11,16-17H2,1-5H3,(H,31,36)(H,33,38)(H,34,37) |
| InChIKey | QTWYBFCENNJNIF-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 120.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.77 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|