About 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride
2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride (PubChem CID 16682348) has the molecular formula C11H13Cl2N3OS
and a molecular weight of 306.22 g/mol. Its IUPAC name is 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
| PubChem CID | 16682348 |
| Molecular Formula | C11H13Cl2N3OS |
| Molecular Weight | 306.22 g/mol |
| Exact Mass | 305.02 |
| IUPAC Name | 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride |
| SMILES | Cl.NCCc1nnc(SCc2ccccc2Cl)o1 |
| InChI | InChI=1S/C11H12ClN3OS.ClH/c12-9-4-2-1-3-8(9)7-17-11-15-14-10(16-11)5-6-13;/h1-4H,5-7,13H2;1H |
| InChIKey | AIUSHWLGTYYSRT-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.22 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride?
The IUPAC name of 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride (CID 16682348) is 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride.
What is the SMILES notation for 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride?
The canonical SMILES for 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride is Cl.NCCc1nnc(SCc2ccccc2Cl)o1.
What is the InChIKey of 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride?
The InChIKey is AIUSHWLGTYYSRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClN3OS.ClH/c12-9-4-2-1-3-8(9)7-17-11-15-14-10(16-11)5-6-13;/h1-4H,5-7,13H2;1H.
What are the key properties of 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride?
2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride has a molecular weight of 306.22 g/mol, XLogP of 2.94, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-[(2-chlorophenyl)methylsulfanyl]-1,3,4-oxadiazol-2-yl]ethanamine;hydrochloride is sourced from PubChem (CID 16682348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).