C21H22ClN3O — CID 16682349
2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide chloride (PubChem CID 16682349) has the molecular formula C21H22ClN3O and a molecular weight of 367.88 g/mol. Its IUPAC name is 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide chloride.
| Compound Name | 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide chloride |
|---|---|
| PubChem CID | 16682349 |
| Molecular Formula | C21H22ClN3O |
| Molecular Weight | 367.88 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 2-[3-(4-methylphenyl)-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium-1-yl]-N-phenylacetamide chloride |
| SMILES | Cc1ccc(-c2c[n+](CC(=O)Nc3ccccc3)c3n2CCC3)cc1.[Cl-] |
| InChI | InChI=1S/C21H21N3O.ClH/c1-16-9-11-17(12-10-16)19-14-23(21-8-5-13-24(19)21)15-20(25)22-18-6-3-2-4-7-18;/h2-4,6-7,9-12,14H,5,8,13,15H2,1H3;1H |
| InChIKey | VPMSAIDFKXHXMA-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.88 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|