C19H28N2O4 — CID 16682350
oxalic acid;1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-4-amine (PubChem CID 16682350) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is oxalic acid;1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-4-amine.
| Compound Name | oxalic acid;1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-4-amine |
|---|---|
| PubChem CID | 16682350 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | oxalic acid;1,2,5-trimethyl-N-phenyl-4-prop-2-enylpiperidin-4-amine |
| SMILES | C=CCC1(Nc2ccccc2)CC(C)N(C)CC1C.O=C(O)C(=O)O |
| InChI | InChI=1S/C17H26N2.C2H2O4/c1-5-11-17(18-16-9-7-6-8-10-16)12-15(3)19(4)13-14(17)2;3-1(4)2(5)6/h5-10,14-15,18H,1,11-13H2,2-4H3;(H,3,4)(H,5,6) |
| InChIKey | PIRYHOACSVWFJL-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|