C17H29N3 — CID 166823558
N-[(Z)-1-[2-[(6S)-3,6-dimethylcyclohexa-1,3-dien-1-yl]ethyl-methylamino]but-1-enyl]-N'-methylmethanimidamide (PubChem CID 166823558) has the molecular formula C17H29N3 and a molecular weight of 275.44 g/mol. Its IUPAC name is N-[(Z)-1-[2-[(6S)-3,6-dimethylcyclohexa-1,3-dien-1-yl]ethyl-methylamino]but-1-enyl]-N'-methylmethanimidamide.
| Compound Name | N-[(Z)-1-[2-[(6S)-3,6-dimethylcyclohexa-1,3-dien-1-yl]ethyl-methylamino]but-1-enyl]-N'-methylmethanimidamide |
|---|---|
| PubChem CID | 166823558 |
| Molecular Formula | C17H29N3 |
| Molecular Weight | 275.44 g/mol |
| Exact Mass | 275.24 |
| IUPAC Name | N-[(Z)-1-[2-[(6S)-3,6-dimethylcyclohexa-1,3-dien-1-yl]ethyl-methylamino]but-1-enyl]-N'-methylmethanimidamide |
| SMILES | CC/C=C(/N/C=N/C)N(C)CCC1=CC(C)=CC[C@@H]1C |
| InChI | InChI=1S/C17H29N3/c1-6-7-17(19-13-18-4)20(5)11-10-16-12-14(2)8-9-15(16)3/h7-8,12-13,15H,6,9-11H2,1-5H3,(H,18,19)/b17-7-/t15-/m0/s1 |
| InChIKey | YEMNJGIKOCKWES-ZRPUOXIQSA-N |
| XLogP | 3.72 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|