About 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride
1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride (PubChem CID 16682374) has the molecular formula C14H20ClNO3
and a molecular weight of 285.77 g/mol. Its IUPAC name is 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride.
Molecular Properties
| Compound Name | 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride |
| PubChem CID | 16682374 |
| Molecular Formula | C14H20ClNO3 |
| Molecular Weight | 285.77 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride |
| SMILES | CC(CN1CCOCC1)OC(=O)c1ccccc1.Cl |
| InChI | InChI=1S/C14H19NO3.ClH/c1-12(11-15-7-9-17-10-8-15)18-14(16)13-5-3-2-4-6-13;/h2-6,12H,7-11H2,1H3;1H |
| InChIKey | XQCXOWQFNDOFRT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.77 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride?
The IUPAC name of 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride (CID 16682374) is 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride.
What is the SMILES notation for 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride?
The canonical SMILES for 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride is CC(CN1CCOCC1)OC(=O)c1ccccc1.Cl.
What is the InChIKey of 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride?
The InChIKey is XQCXOWQFNDOFRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO3.ClH/c1-12(11-15-7-9-17-10-8-15)18-14(16)13-5-3-2-4-6-13;/h2-6,12H,7-11H2,1H3;1H.
What are the key properties of 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride?
1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride has a molecular weight of 285.77 g/mol, XLogP of 1.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-morpholin-4-ylpropan-2-yl benzoate;hydrochloride is sourced from PubChem (CID 16682374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).