About 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride
3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride (PubChem CID 16682378) has the molecular formula C19H17Cl3N2
and a molecular weight of 379.72 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
| PubChem CID | 16682378 |
| Molecular Formula | C19H17Cl3N2 |
| Molecular Weight | 379.72 g/mol |
| Exact Mass | 378.05 |
| IUPAC Name | 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride |
| SMILES | Clc1ccc(C[n+]2cc(-c3ccc(Cl)cc3)n3c2CCC3)cc1.[Cl-] |
| InChI | InChI=1S/C19H17Cl2N2.ClH/c20-16-7-3-14(4-8-16)12-22-13-18(23-11-1-2-19(22)23)15-5-9-17(21)10-6-15;/h3-10,13H,1-2,11-12H2;1H/q+1;/p-1 |
| InChIKey | FBMBHVUGZJVISH-UHFFFAOYSA-M |
| XLogP | 1.75 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride?
The IUPAC name of 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride (CID 16682378) is 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride.
What is the SMILES notation for 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride?
The canonical SMILES for 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride is Clc1ccc(C[n+]2cc(-c3ccc(Cl)cc3)n3c2CCC3)cc1.[Cl-].
What is the InChIKey of 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride?
The InChIKey is FBMBHVUGZJVISH-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H17Cl2N2.ClH/c20-16-7-3-14(4-8-16)12-22-13-18(23-11-1-2-19(22)23)15-5-9-17(21)10-6-15;/h3-10,13H,1-2,11-12H2;1H/q+1;/p-1.
What are the key properties of 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride?
3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride has a molecular weight of 379.72 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-1-[(4-chlorophenyl)methyl]-6,7-dihydro-5H-pyrrolo[1,2-a]imidazol-1-ium chloride is sourced from PubChem (CID 16682378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).