About dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium
dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium (PubChem CID 16682387) has the molecular formula C13H15FNO4PS
and a molecular weight of 331.31 g/mol. Its IUPAC name is dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium.
Molecular Properties
| Compound Name | dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium |
| PubChem CID | 16682387 |
| Molecular Formula | C13H15FNO4PS |
| Molecular Weight | 331.31 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium |
| SMILES | Fc1ccc(SCCc2cccc[nH+]2)cc1.O=P([O-])(O)O |
| InChI | InChI=1S/C13H12FNS.H3O4P/c14-11-4-6-13(7-5-11)16-10-8-12-3-1-2-9-15-12;1-5(2,3)4/h1-7,9H,8,10H2;(H3,1,2,3,4) |
| InChIKey | AVMLTUPLMJTDPD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 94.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium?
The IUPAC name of dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium (CID 16682387) is dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium.
What is the SMILES notation for dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium?
The canonical SMILES for dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium is Fc1ccc(SCCc2cccc[nH+]2)cc1.O=P([O-])(O)O.
What is the InChIKey of dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium?
The InChIKey is AVMLTUPLMJTDPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNS.H3O4P/c14-11-4-6-13(7-5-11)16-10-8-12-3-1-2-9-15-12;1-5(2,3)4/h1-7,9H,8,10H2;(H3,1,2,3,4).
What are the key properties of dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium?
dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium has a molecular weight of 331.31 g/mol, XLogP of 1.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dihydrogen phosphate;2-[2-(4-fluorophenyl)sulfanylethyl]pyridin-1-ium is sourced from PubChem (CID 16682387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).