About 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine
4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine (PubChem CID 166823919) has the molecular formula C10H13N
and a molecular weight of 147.22 g/mol. Its IUPAC name is 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine.
Analyze 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine?
The IUPAC name of 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine (CID 166823919) is 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine.
What is the SMILES notation for 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine?
The canonical SMILES for 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine is CC1=NC=CC2CCCC2=C1.
What is the InChIKey of 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine?
The InChIKey is LVIWDSXQCOJGDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N/c1-8-7-10-4-2-3-9(10)5-6-11-8/h5-7,9H,2-4H2,1H3.
What are the key properties of 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine?
4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine has a molecular weight of 147.22 g/mol, XLogP of 2.70, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-6,7,8,8a-tetrahydrocyclopenta[d]azepine is sourced from PubChem (CID 166823919), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).