C15H21F4N — CID 166823969
(E,5E)-7,9,9,9-tetrafluoro-N,6,8-trimethyl-5-prop-2-enylidenenon-6-en-4-imine (PubChem CID 166823969) has the molecular formula C15H21F4N and a molecular weight of 291.33 g/mol. Its IUPAC name is (E,5E)-7,9,9,9-tetrafluoro-N,6,8-trimethyl-5-prop-2-enylidenenon-6-en-4-imine.
| Compound Name | (E,5E)-7,9,9,9-tetrafluoro-N,6,8-trimethyl-5-prop-2-enylidenenon-6-en-4-imine |
|---|---|
| PubChem CID | 166823969 |
| Molecular Formula | C15H21F4N |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | (E,5E)-7,9,9,9-tetrafluoro-N,6,8-trimethyl-5-prop-2-enylidenenon-6-en-4-imine |
| SMILES | C=C/C=C(C(/CCC)=N/C)\C(C)=C(\F)C(C)C(F)(F)F |
| InChI | InChI=1S/C15H21F4N/c1-6-8-12(13(20-5)9-7-2)10(3)14(16)11(4)15(17,18)19/h6,8,11H,1,7,9H2,2-5H3/b12-8+,14-10+,20-13+ |
| InChIKey | YMLHDCVKAHSWFF-LBRJINGISA-N |
| XLogP | 5.41 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|