C41H39N3S — CID 166824214
2-[4-(1,2,10,10a-tetrahydronaphtho[1,2-b][1]benzothiol-7-yl)-3,4-dihydronaphthalen-1-yl]-4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazinane (PubChem CID 166824214) has the molecular formula C41H39N3S and a molecular weight of 605.85 g/mol. Its IUPAC name is 2-[4-(1,2,10,10a-tetrahydronaphtho[1,2-b][1]benzothiol-7-yl)-3,4-dihydronaphthalen-1-yl]-4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazinane.
| Compound Name | 2-[4-(1,2,10,10a-tetrahydronaphtho[1,2-b][1]benzothiol-7-yl)-3,4-dihydronaphthalen-1-yl]-4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazinane |
|---|---|
| PubChem CID | 166824214 |
| Molecular Formula | C41H39N3S |
| Molecular Weight | 605.85 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | 2-[4-(1,2,10,10a-tetrahydronaphtho[1,2-b][1]benzothiol-7-yl)-3,4-dihydronaphthalen-1-yl]-4-cyclohexa-2,4-dien-1-yl-6-phenyl-1,3,5-triazinane |
| SMILES | C1=CCC(C2NC(C3=CCC(C4=C5c6ccc7c(c6SC5CC=C4)CCC=C7)c4ccccc43)NC(c3ccccc3)N2)C=C1 |
| InChI | InChI=1S/C41H39N3S/c1-3-13-27(14-4-1)39-42-40(28-15-5-2-6-16-28)44-41(43-39)34-25-24-32(30-18-9-10-19-31(30)34)33-20-11-21-36-37(33)35-23-22-26-12-7-8-17-29(26)38(35)45-36/h1-7,9-15,18-20,22-23,25,28,32,36,39-44H,8,16-17,21,24H2 |
| InChIKey | YXLLNXVEJUCSSI-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.85 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |