About 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride
2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (PubChem CID 16682443) has the molecular formula C6H13ClN4
and a molecular weight of 176.65 g/mol. Its IUPAC name is 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| PubChem CID | 16682443 |
| Molecular Formula | C6H13ClN4 |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride |
| SMILES | CCc1n[nH]c(CCN)n1.Cl |
| InChI | InChI=1S/C6H12N4.ClH/c1-2-5-8-6(3-4-7)10-9-5;/h2-4,7H2,1H3,(H,8,9,10);1H |
| InChIKey | WPFFVRYRUZBYAK-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The IUPAC name of 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride (CID 16682443) is 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride.
What is the SMILES notation for 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The canonical SMILES for 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride is CCc1n[nH]c(CCN)n1.Cl.
What is the InChIKey of 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
The InChIKey is WPFFVRYRUZBYAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N4.ClH/c1-2-5-8-6(3-4-7)10-9-5;/h2-4,7H2,1H3,(H,8,9,10);1H.
What are the key properties of 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride?
2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride has a molecular weight of 176.65 g/mol, XLogP of 0.29, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-ethyl-1H-1,2,4-triazol-5-yl)ethanamine;hydrochloride is sourced from PubChem (CID 16682443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).