About 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate
3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate (PubChem CID 16682454) has the molecular formula C22H16NO4-
and a molecular weight of 358.37 g/mol. Its IUPAC name is 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate.
Molecular Properties
| Compound Name | 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate |
| PubChem CID | 16682454 |
| Molecular Formula | C22H16NO4- |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate |
| SMILES | O.O=C([O-])c1ccn2c(C(=O)c3ccccc3)c(-c3ccccc3)cc2c1 |
| InChI | InChI=1S/C22H15NO3.H2O/c24-21(16-9-5-2-6-10-16)20-19(15-7-3-1-4-8-15)14-18-13-17(22(25)26)11-12-23(18)20;/h1-14H,(H,25,26);1H2/p-1 |
| InChIKey | KEQDACGKADRZRK-UHFFFAOYSA-M |
| XLogP | 2.38 |
| TPSA | 93.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_65_I(1)', 'substructure': 'N/A'} |
|---|
Analyze 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate?
The IUPAC name of 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate (CID 16682454) is 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate.
What is the SMILES notation for 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate?
The canonical SMILES for 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate is O.O=C([O-])c1ccn2c(C(=O)c3ccccc3)c(-c3ccccc3)cc2c1.
What is the InChIKey of 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate?
The InChIKey is KEQDACGKADRZRK-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H15NO3.H2O/c24-21(16-9-5-2-6-10-16)20-19(15-7-3-1-4-8-15)14-18-13-17(22(25)26)11-12-23(18)20;/h1-14H,(H,25,26);1H2/p-1.
What are the key properties of 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate?
3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate has a molecular weight of 358.37 g/mol, XLogP of 2.38, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzoyl-2-phenylindolizine-7-carboxylate;hydrate is sourced from PubChem (CID 16682454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).