C25H39N — CID 166824733
(7Z)-3-but-1-en-2-yl-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-9a-amine (PubChem CID 166824733) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is (7Z)-3-but-1-en-2-yl-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-9a-amine.
| Compound Name | (7Z)-3-but-1-en-2-yl-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-9a-amine |
|---|---|
| PubChem CID | 166824733 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (7Z)-3-but-1-en-2-yl-3a,6-dimethyl-6-[(Z)-prop-1-enyl]-7-prop-2-enylidene-2,3,4,5,5a,8,9,9b-octahydro-1H-cyclopenta[a]naphthalen-9a-amine |
| SMILES | C=C/C=C1/CCC2(N)C(CCC3(C)C(C(=C)CC)CCC32)C1(C)/C=C\C |
| InChI | InChI=1S/C25H39N/c1-7-10-19-13-17-25(26)21-12-11-20(18(4)9-3)24(21,6)16-14-22(25)23(19,5)15-8-2/h7-8,10,15,20-22H,1,4,9,11-14,16-17,26H2,2-3,5-6H3/b15-8-,19-10- |
| InChIKey | MXKDFADENCNCPA-RECNLNOQSA-N |
| XLogP | 6.58 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|