About N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride
N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (PubChem CID 16682474) has the molecular formula C19H18ClN3O2
and a molecular weight of 355.83 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
Molecular Properties
| Compound Name | N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| PubChem CID | 16682474 |
| Molecular Formula | C19H18ClN3O2 |
| Molecular Weight | 355.83 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride |
| SMILES | COCCNc1nc(-c2ccccc2)nc2c1oc1ccccc12.Cl |
| InChI | InChI=1S/C19H17N3O2.ClH/c1-23-12-11-20-19-17-16(14-9-5-6-10-15(14)24-17)21-18(22-19)13-7-3-2-4-8-13;/h2-10H,11-12H2,1H3,(H,20,21,22);1H |
| InChIKey | KXJCJJBFXMGAFU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.83 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The IUPAC name of N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride (CID 16682474) is N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride.
What is the SMILES notation for N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The canonical SMILES for N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is COCCNc1nc(-c2ccccc2)nc2c1oc1ccccc12.Cl.
What is the InChIKey of N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
The InChIKey is KXJCJJBFXMGAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3O2.ClH/c1-23-12-11-20-19-17-16(14-9-5-6-10-15(14)24-17)21-18(22-19)13-7-3-2-4-8-13;/h2-10H,11-12H2,1H3,(H,20,21,22);1H.
What are the key properties of N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride?
N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride has a molecular weight of 355.83 g/mol, XLogP of 4.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methoxyethyl)-2-phenyl-[1]benzofuro[3,2-d]pyrimidin-4-amine;hydrochloride is sourced from PubChem (CID 16682474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).