About 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine
7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine (PubChem CID 166825056) has the molecular formula C7H10N4
and a molecular weight of 150.18 g/mol. Its IUPAC name is 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine |
| PubChem CID | 166825056 |
| Molecular Formula | C7H10N4 |
| Molecular Weight | 150.18 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine |
| SMILES | CC1=CNC2C(N)=NC=NC12 |
| InChI | InChI=1S/C7H10N4/c1-4-2-9-6-5(4)10-3-11-7(6)8/h2-3,5-6,9H,1H3,(H2,8,10,11) |
| InChIKey | GSMGIAVAIYUWOF-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.18 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine?
The IUPAC name of 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine (CID 166825056) is 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine.
What is the SMILES notation for 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine?
The canonical SMILES for 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine is CC1=CNC2C(N)=NC=NC12.
What is the InChIKey of 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine?
The InChIKey is GSMGIAVAIYUWOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N4/c1-4-2-9-6-5(4)10-3-11-7(6)8/h2-3,5-6,9H,1H3,(H2,8,10,11).
What are the key properties of 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine?
7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine has a molecular weight of 150.18 g/mol, XLogP of -0.37, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-5,7a-dihydro-4aH-pyrrolo[3,2-d]pyrimidin-4-amine is sourced from PubChem (CID 166825056), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).