About 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride
2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride (PubChem CID 16682524) has the molecular formula C14H18ClN3OS
and a molecular weight of 311.84 g/mol. Its IUPAC name is 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride.
Molecular Properties
| Compound Name | 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride |
| PubChem CID | 16682524 |
| Molecular Formula | C14H18ClN3OS |
| Molecular Weight | 311.84 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride |
| SMILES | Cc1ccccc1CSc1nnc([C@@H]2CCCN2)o1.Cl |
| InChI | InChI=1S/C14H17N3OS.ClH/c1-10-5-2-3-6-11(10)9-19-14-17-16-13(18-14)12-7-4-8-15-12;/h2-3,5-6,12,15H,4,7-9H2,1H3;1H/t12-;/m0./s1 |
| InChIKey | QSBYSGJNRURPFR-YDALLXLXSA-N |
| XLogP | 3.52 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride?
The IUPAC name of 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride (CID 16682524) is 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride.
What is the SMILES notation for 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride?
The canonical SMILES for 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride is Cc1ccccc1CSc1nnc([C@@H]2CCCN2)o1.Cl.
What is the InChIKey of 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride?
The InChIKey is QSBYSGJNRURPFR-YDALLXLXSA-N. The full InChI is InChI=1S/C14H17N3OS.ClH/c1-10-5-2-3-6-11(10)9-19-14-17-16-13(18-14)12-7-4-8-15-12;/h2-3,5-6,12,15H,4,7-9H2,1H3;1H/t12-;/m0./s1.
What are the key properties of 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride?
2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride has a molecular weight of 311.84 g/mol, XLogP of 3.52, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-methylphenyl)methylsulfanyl]-5-[(2S)-pyrrolidin-2-yl]-1,3,4-oxadiazole;hydrochloride is sourced from PubChem (CID 16682524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).