C20H21F6N7O2 — CID 166825331
5-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxamide (PubChem CID 166825331) has the molecular formula C20H21F6N7O2 and a molecular weight of 505.42 g/mol. Its IUPAC name is 5-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxamide.
| Compound Name | 5-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 166825331 |
| Molecular Formula | C20H21F6N7O2 |
| Molecular Weight | 505.42 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | 5-methyl-N-[[7-[(4,4,4-trifluorobutanoylamino)methyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-1-(3,3,3-trifluoropropyl)pyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)NCc2cn3ncc(CNC(=O)CCC(F)(F)F)cc3n2)cnn1CCC(F)(F)F |
| InChI | InChI=1S/C20H21F6N7O2/c1-12-15(10-30-32(12)5-4-20(24,25)26)18(35)28-9-14-11-33-16(31-14)6-13(8-29-33)7-27-17(34)2-3-19(21,22)23/h6,8,10-11H,2-5,7,9H2,1H3,(H,27,34)(H,28,35) |
| InChIKey | HQPOTIGXKIKOJG-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.42 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |