C16H23IN2O2 — CID 16682552
4-[(1-methylpiperidin-1-ium-1-yl)methyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione iodide (PubChem CID 16682552) has the molecular formula C16H23IN2O2 and a molecular weight of 402.28 g/mol. Its IUPAC name is 4-[(1-methylpiperidin-1-ium-1-yl)methyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione iodide.
| Compound Name | 4-[(1-methylpiperidin-1-ium-1-yl)methyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione iodide |
|---|---|
| PubChem CID | 16682552 |
| Molecular Formula | C16H23IN2O2 |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-[(1-methylpiperidin-1-ium-1-yl)methyl]-4-azatricyclo[5.2.1.02,6]dec-8-ene-3,5-dione iodide |
| SMILES | C[N+]1(CN2C(=O)C3C4C=CC(C4)C3C2=O)CCCCC1.[I-] |
| InChI | InChI=1S/C16H23N2O2.HI/c1-18(7-3-2-4-8-18)10-17-15(19)13-11-5-6-12(9-11)14(13)16(17)20;/h5-6,11-14H,2-4,7-10H2,1H3;1H/q+1;/p-1 |
| InChIKey | OKRBVTSYJHXRNO-UHFFFAOYSA-M |
| XLogP | -1.61 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|