C23H27F2N7O3 — CID 166825663
N-[[7-[(1S)-2-cyclobutyl-1-[[2-(3,3-difluorocyclobutyl)acetyl]amino]ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide (PubChem CID 166825663) has the molecular formula C23H27F2N7O3 and a molecular weight of 487.51 g/mol. Its IUPAC name is N-[[7-[(1S)-2-cyclobutyl-1-[[2-(3,3-difluorocyclobutyl)acetyl]amino]ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide.
| Compound Name | N-[[7-[(1S)-2-cyclobutyl-1-[[2-(3,3-difluorocyclobutyl)acetyl]amino]ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
|---|---|
| PubChem CID | 166825663 |
| Molecular Formula | C23H27F2N7O3 |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | N-[[7-[(1S)-2-cyclobutyl-1-[[2-(3,3-difluorocyclobutyl)acetyl]amino]ethyl]imidazo[1,2-b]pyridazin-2-yl]methyl]-4-methyl-1,2,5-oxadiazole-3-carboxamide |
| SMILES | Cc1nonc1C(=O)NCc1cn2ncc([C@H](CC3CCC3)NC(=O)CC3CC(F)(F)C3)cc2n1 |
| InChI | InChI=1S/C23H27F2N7O3/c1-13-21(31-35-30-13)22(34)26-11-17-12-32-19(28-17)7-16(10-27-32)18(5-14-3-2-4-14)29-20(33)6-15-8-23(24,25)9-15/h7,10,12,14-15,18H,2-6,8-9,11H2,1H3,(H,26,34)(H,29,33)/t18-/m0/s1 |
| InChIKey | AIUGDSDKFIKMFV-SFHVURJKSA-N |
| XLogP | 3.13 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |