C23H20F4O2 — CID 166826298
1-(2,6-dimethylphenoxy)-2,3,5,6-tetrafluoro-4-(2,4,6-trimethylphenoxy)benzene (PubChem CID 166826298) has the molecular formula C23H20F4O2 and a molecular weight of 404.40 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-2,3,5,6-tetrafluoro-4-(2,4,6-trimethylphenoxy)benzene.
| Compound Name | 1-(2,6-dimethylphenoxy)-2,3,5,6-tetrafluoro-4-(2,4,6-trimethylphenoxy)benzene |
|---|---|
| PubChem CID | 166826298 |
| Molecular Formula | C23H20F4O2 |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-2,3,5,6-tetrafluoro-4-(2,4,6-trimethylphenoxy)benzene |
| SMILES | Cc1cc(C)c(Oc2c(F)c(F)c(Oc3c(C)cccc3C)c(F)c2F)c(C)c1 |
| InChI | InChI=1S/C23H20F4O2/c1-11-9-14(4)21(15(5)10-11)29-23-18(26)16(24)22(17(25)19(23)27)28-20-12(2)7-6-8-13(20)3/h6-10H,1-5H3 |
| InChIKey | HWIPQQBEHOMJGZ-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|