C24H22N2O4S — CID 16682690
3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylic acid;1,4-dioxane (PubChem CID 16682690) has the molecular formula C24H22N2O4S and a molecular weight of 434.52 g/mol. Its IUPAC name is 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylic acid;1,4-dioxane.
| Compound Name | 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylic acid;1,4-dioxane |
|---|---|
| PubChem CID | 16682690 |
| Molecular Formula | C24H22N2O4S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | 3-amino-4,6-diphenylthieno[2,3-b]pyridine-2-carboxylic acid;1,4-dioxane |
| SMILES | C1COCCO1.Nc1c(C(=O)O)sc2nc(-c3ccccc3)cc(-c3ccccc3)c12 |
| InChI | InChI=1S/C20H14N2O2S.C4H8O2/c21-17-16-14(12-7-3-1-4-8-12)11-15(13-9-5-2-6-10-13)22-19(16)25-18(17)20(23)24;1-2-6-4-3-5-1/h1-11H,21H2,(H,23,24);1-4H2 |
| InChIKey | HBDWSQXHDCBOAM-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 94.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |