About 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride
8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride (PubChem CID 16682697) has the molecular formula C14H17ClN4O2
and a molecular weight of 308.77 g/mol. Its IUPAC name is 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride.
Molecular Properties
| Compound Name | 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride |
| PubChem CID | 16682697 |
| Molecular Formula | C14H17ClN4O2 |
| Molecular Weight | 308.77 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(N2CCCNCC2)c2ncccc12 |
| InChI | InChI=1S/C14H16N4O2.ClH/c19-18(20)12-4-5-13(14-11(12)3-1-7-16-14)17-9-2-6-15-8-10-17;/h1,3-5,7,15H,2,6,8-10H2;1H |
| InChIKey | RLFLRJQCYGPBCP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 71.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.77 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride?
The IUPAC name of 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride (CID 16682697) is 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride.
What is the SMILES notation for 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride?
The canonical SMILES for 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride is Cl.O=[N+]([O-])c1ccc(N2CCCNCC2)c2ncccc12.
What is the InChIKey of 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride?
The InChIKey is RLFLRJQCYGPBCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N4O2.ClH/c19-18(20)12-4-5-13(14-11(12)3-1-7-16-14)17-9-2-6-15-8-10-17;/h1,3-5,7,15H,2,6,8-10H2;1H.
What are the key properties of 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride?
8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride has a molecular weight of 308.77 g/mol, XLogP of 2.36, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(1,4-diazepan-1-yl)-5-nitroquinoline;hydrochloride is sourced from PubChem (CID 16682697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).