About (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol
(3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol (PubChem CID 16682719) has the molecular formula C17H19N3O3
and a molecular weight of 313.36 g/mol. Its IUPAC name is (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol.
Molecular Properties
| Compound Name | (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol |
| PubChem CID | 16682719 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol |
| SMILES | O[C@@H]1COC(Nc2ccc(/N=N/c3ccccc3)cc2)C[C@@H]1O |
| InChI | InChI=1S/C17H19N3O3/c21-15-10-17(23-11-16(15)22)18-12-6-8-14(9-7-12)20-19-13-4-2-1-3-5-13/h1-9,15-18,21-22H,10-11H2/b20-19+/t15-,16+,17?/m0/s1 |
| InChIKey | MKDQKKFKZDPVME-VOCQWKNSSA-N |
| XLogP | 2.98 |
| TPSA | 86.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol?
The IUPAC name of (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol (CID 16682719) is (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol.
What is the SMILES notation for (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol?
The canonical SMILES for (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol is O[C@@H]1COC(Nc2ccc(/N=N/c3ccccc3)cc2)C[C@@H]1O.
What is the InChIKey of (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol?
The InChIKey is MKDQKKFKZDPVME-VOCQWKNSSA-N. The full InChI is InChI=1S/C17H19N3O3/c21-15-10-17(23-11-16(15)22)18-12-6-8-14(9-7-12)20-19-13-4-2-1-3-5-13/h1-9,15-18,21-22H,10-11H2/b20-19+/t15-,16+,17?/m0/s1.
What are the key properties of (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol?
(3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol has a molecular weight of 313.36 g/mol, XLogP of 2.98, 4 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,4S)-6-(4-phenyldiazenylanilino)oxane-3,4-diol is sourced from PubChem (CID 16682719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).