About [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone
[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone (PubChem CID 166827496) has the molecular formula C10H14F2N4O
and a molecular weight of 244.24 g/mol. Its IUPAC name is [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone.
Molecular Properties
| Compound Name | [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone |
| PubChem CID | 166827496 |
| Molecular Formula | C10H14F2N4O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone |
| SMILES | CNn1cc(C(=O)N2C[C@@H](F)[C@@H](F)C2)nc1C |
| InChI | InChI=1S/C10H14F2N4O/c1-6-14-9(5-16(6)13-2)10(17)15-3-7(11)8(12)4-15/h5,7-8,13H,3-4H2,1-2H3/t7-,8+ |
| InChIKey | ACNPKYPGDYKNBX-OCAPTIKFSA-N |
| XLogP | 0.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone?
The IUPAC name of [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone (CID 166827496) is [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone.
What is the SMILES notation for [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone?
The canonical SMILES for [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone is CNn1cc(C(=O)N2C[C@@H](F)[C@@H](F)C2)nc1C.
What is the InChIKey of [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone?
The InChIKey is ACNPKYPGDYKNBX-OCAPTIKFSA-N. The full InChI is InChI=1S/C10H14F2N4O/c1-6-14-9(5-16(6)13-2)10(17)15-3-7(11)8(12)4-15/h5,7-8,13H,3-4H2,1-2H3/t7-,8+.
What are the key properties of [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone?
[(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone has a molecular weight of 244.24 g/mol, XLogP of 0.50, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4S)-3,4-difluoropyrrolidin-1-yl]-[2-methyl-1-(methylamino)imidazol-4-yl]methanone is sourced from PubChem (CID 166827496), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).