About 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]
2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] (PubChem CID 166828390) has the molecular formula C14H16O
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane].
Molecular Properties
| Compound Name | 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] |
| PubChem CID | 166828390 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] |
| SMILES | C=CC1CC12CCOc1cc(C)ccc12 |
| InChI | InChI=1S/C14H16O/c1-3-11-9-14(11)6-7-15-13-8-10(2)4-5-12(13)14/h3-5,8,11H,1,6-7,9H2,2H3 |
| InChIKey | KJGMUKOYGQJQTK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]?
The IUPAC name of 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] (CID 166828390) is 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane].
What is the SMILES notation for 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]?
The canonical SMILES for 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] is C=CC1CC12CCOc1cc(C)ccc12.
What is the InChIKey of 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]?
The InChIKey is KJGMUKOYGQJQTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16O/c1-3-11-9-14(11)6-7-15-13-8-10(2)4-5-12(13)14/h3-5,8,11H,1,6-7,9H2,2H3.
What are the key properties of 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane]?
2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] has a molecular weight of 200.28 g/mol, XLogP of 3.22, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-ethenyl-7-methylspiro[2,3-dihydrochromene-4,1'-cyclopropane] is sourced from PubChem (CID 166828390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).