About [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate
[(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate (PubChem CID 16682859) has the molecular formula C14H14Cl2O4S2Sn
and a molecular weight of 500.01 g/mol. Its IUPAC name is [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate.
Molecular Properties
| Compound Name | [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate |
| PubChem CID | 16682859 |
| Molecular Formula | C14H14Cl2O4S2Sn |
| Molecular Weight | 500.01 g/mol |
| Exact Mass | 499.87 |
| IUPAC Name | [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate |
| SMILES | C[Sn](C)(OS(=O)c1ccc(Cl)cc1)OS(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/2C6H5ClO2S.2CH3.Sn/c2*7-5-1-3-6(4-2-5)10(8)9;;;/h2*1-4H,(H,8,9);2*1H3;/q;;;;+2/p-2 |
| InChIKey | WDHNLVOKWRKWBB-UHFFFAOYSA-L |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 500.01 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate?
The IUPAC name of [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate (CID 16682859) is [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate.
What is the SMILES notation for [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate?
The canonical SMILES for [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate is C[Sn](C)(OS(=O)c1ccc(Cl)cc1)OS(=O)c1ccc(Cl)cc1.
What is the InChIKey of [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate?
The InChIKey is WDHNLVOKWRKWBB-UHFFFAOYSA-L. The full InChI is InChI=1S/2C6H5ClO2S.2CH3.Sn/c2*7-5-1-3-6(4-2-5)10(8)9;;;/h2*1-4H,(H,8,9);2*1H3;/q;;;;+2/p-2.
What are the key properties of [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate?
[(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate has a molecular weight of 500.01 g/mol, XLogP of 4.47, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(4-chlorophenyl)sulfinyloxy-dimethylstannyl] 4-chlorobenzenesulfinate is sourced from PubChem (CID 16682859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).