C13H23NO3S — CID 166828833
2-amino-3-[(4-methoxycyclohexa-1,3-dien-1-yl)methylsulfanyl]-3-methylbutane-1,1-diol (PubChem CID 166828833) has the molecular formula C13H23NO3S and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-amino-3-[(4-methoxycyclohexa-1,3-dien-1-yl)methylsulfanyl]-3-methylbutane-1,1-diol.
| Compound Name | 2-amino-3-[(4-methoxycyclohexa-1,3-dien-1-yl)methylsulfanyl]-3-methylbutane-1,1-diol |
|---|---|
| PubChem CID | 166828833 |
| Molecular Formula | C13H23NO3S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 2-amino-3-[(4-methoxycyclohexa-1,3-dien-1-yl)methylsulfanyl]-3-methylbutane-1,1-diol |
| SMILES | COC1=CC=C(CSC(C)(C)C(N)C(O)O)CC1 |
| InChI | InChI=1S/C13H23NO3S/c1-13(2,11(14)12(15)16)18-8-9-4-6-10(17-3)7-5-9/h4,6,11-12,15-16H,5,7-8,14H2,1-3H3 |
| InChIKey | QMYPORYDQNFNRL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|