About diethylmethoxygermane
diethylmethoxygermane (PubChem CID 16682889) has the molecular formula C5H13GeO
and a molecular weight of 161.77 g/mol.
Molecular Properties
| Compound Name | diethylmethoxygermane |
| PubChem CID | 16682889 |
| Molecular Formula | C5H13GeO |
| Molecular Weight | 161.77 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | — |
| SMILES | CC[Ge](CC)OC |
| InChI | InChI=1S/C5H13GeO/c1-4-6(5-2)7-3/h4-5H2,1-3H3 |
| InChIKey | QTDAYCCIWDEJHG-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.77 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze diethylmethoxygermane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethylmethoxygermane?
The IUPAC name of diethylmethoxygermane (CID 16682889) is not available.
What is the SMILES notation for diethylmethoxygermane?
The canonical SMILES for diethylmethoxygermane is CC[Ge](CC)OC.
What is the InChIKey of diethylmethoxygermane?
The InChIKey is QTDAYCCIWDEJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13GeO/c1-4-6(5-2)7-3/h4-5H2,1-3H3.
What are the key properties of diethylmethoxygermane?
diethylmethoxygermane has a molecular weight of 161.77 g/mol, XLogP of 1.66, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diethylmethoxygermane is sourced from PubChem (CID 16682889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).