C26H23FN6O2S — CID 166829048
2-[2-[4-[5-amino-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]-3-pyridinyl]ethanethial (PubChem CID 166829048) has the molecular formula C26H23FN6O2S and a molecular weight of 502.58 g/mol. Its IUPAC name is 2-[2-[4-[5-amino-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]-3-pyridinyl]ethanethial.
| Compound Name | 2-[2-[4-[5-amino-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]-3-pyridinyl]ethanethial |
|---|---|
| PubChem CID | 166829048 |
| Molecular Formula | C26H23FN6O2S |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.16 |
| IUPAC Name | 2-[2-[4-[5-amino-1-(1-prop-2-enoylpyrrolidin-3-yl)imidazo[1,5-c]pyrimidin-3-yl]-2-fluorophenoxy]-3-pyridinyl]ethanethial |
| SMILES | C=CC(=O)N1CCC(c2nc(-c3ccc(Oc4ncccc4CC=S)c(F)c3)n3c(N)nccc23)C1 |
| InChI | InChI=1S/C26H23FN6O2S/c1-2-22(34)32-12-8-18(15-32)23-20-7-11-30-26(28)33(20)24(31-23)17-5-6-21(19(27)14-17)35-25-16(9-13-36)4-3-10-29-25/h2-7,10-11,13-14,18H,1,8-9,12,15H2,(H2,28,30) |
| InChIKey | ALHHPEMZJSBGKW-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|