About nitrooxy(phenyl)mercury
nitrooxy(phenyl)mercury (PubChem CID 16682924) has the molecular formula C6H5HgNO3
and a molecular weight of 339.70 g/mol. Its IUPAC name is nitrooxy(phenyl)mercury.
Molecular Properties
| Compound Name | nitrooxy(phenyl)mercury |
| PubChem CID | 16682924 |
| Molecular Formula | C6H5HgNO3 |
| Molecular Weight | 339.70 g/mol |
| Exact Mass | 341.00 |
| IUPAC Name | nitrooxy(phenyl)mercury |
| SMILES | O=[N+]([O-])O[Hg]c1ccccc1 |
| InChI | InChI=1S/C6H5.Hg.NO3/c1-2-4-6-5-3-1;;2-1(3)4/h1-5H;;/q;+1;-1 |
| InChIKey | PDTFCHSETJBPTR-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.70 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitrooxy(phenyl)mercury with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrooxy(phenyl)mercury?
The IUPAC name of nitrooxy(phenyl)mercury (CID 16682924) is nitrooxy(phenyl)mercury.
What is the SMILES notation for nitrooxy(phenyl)mercury?
The canonical SMILES for nitrooxy(phenyl)mercury is O=[N+]([O-])O[Hg]c1ccccc1.
What is the InChIKey of nitrooxy(phenyl)mercury?
The InChIKey is PDTFCHSETJBPTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5.Hg.NO3/c1-2-4-6-5-3-1;;2-1(3)4/h1-5H;;/q;+1;-1.
What are the key properties of nitrooxy(phenyl)mercury?
nitrooxy(phenyl)mercury has a molecular weight of 339.70 g/mol, XLogP of 0.52, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitrooxy(phenyl)mercury is sourced from PubChem (CID 16682924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).