About 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal
4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal (PubChem CID 166829329) has the molecular formula C13H22N2O3
and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal.
Molecular Properties
| Compound Name | 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal |
| PubChem CID | 166829329 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal |
| SMILES | CCC(C)(C=O)CC(C)(C)N1C(=O)CC(N)C1=O |
| InChI | InChI=1S/C13H22N2O3/c1-5-13(4,8-16)7-12(2,3)15-10(17)6-9(14)11(15)18/h8-9H,5-7,14H2,1-4H3 |
| InChIKey | VHVSETPHFJSEQM-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal?
The IUPAC name of 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal (CID 166829329) is 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal.
What is the SMILES notation for 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal?
The canonical SMILES for 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal is CCC(C)(C=O)CC(C)(C)N1C(=O)CC(N)C1=O.
What is the InChIKey of 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal?
The InChIKey is VHVSETPHFJSEQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2O3/c1-5-13(4,8-16)7-12(2,3)15-10(17)6-9(14)11(15)18/h8-9H,5-7,14H2,1-4H3.
What are the key properties of 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal?
4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal has a molecular weight of 254.33 g/mol, XLogP of 0.86, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-amino-2,5-dioxopyrrolidin-1-yl)-2-ethyl-2,4-dimethylpentanal is sourced from PubChem (CID 166829329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).