C30H31NO3 — CID 166829501
[3-[methyl-[(2E,4Z)-2-methylhexa-2,4-dienoyl]amino]-1,3-diphenylpropyl] benzoate (PubChem CID 166829501) has the molecular formula C30H31NO3 and a molecular weight of 453.58 g/mol. Its IUPAC name is [3-[methyl-[(2E,4Z)-2-methylhexa-2,4-dienoyl]amino]-1,3-diphenylpropyl] benzoate.
| Compound Name | [3-[methyl-[(2E,4Z)-2-methylhexa-2,4-dienoyl]amino]-1,3-diphenylpropyl] benzoate |
|---|---|
| PubChem CID | 166829501 |
| Molecular Formula | C30H31NO3 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | [3-[methyl-[(2E,4Z)-2-methylhexa-2,4-dienoyl]amino]-1,3-diphenylpropyl] benzoate |
| SMILES | C/C=C\C=C(/C)C(=O)N(C)C(CC(OC(=O)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H31NO3/c1-4-5-15-23(2)29(32)31(3)27(24-16-9-6-10-17-24)22-28(25-18-11-7-12-19-25)34-30(33)26-20-13-8-14-21-26/h4-21,27-28H,22H2,1-3H3/b5-4-,23-15+ |
| InChIKey | WTDNZRJBHGNFAO-HCIDEVLVSA-N |
| XLogP | 6.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|