C20H27N7O3S — CID 166829572
1-amino-3-[4-[4-[2-[(E)-1-(2-amino-1,3-thiazol-4-yl)ethylideneamino]oxyethoxy]phenyl]-2-imino-3-methylimidazol-1-yl]propan-2-ol (PubChem CID 166829572) has the molecular formula C20H27N7O3S and a molecular weight of 445.55 g/mol. Its IUPAC name is 1-amino-3-[4-[4-[2-[(E)-1-(2-amino-1,3-thiazol-4-yl)ethylideneamino]oxyethoxy]phenyl]-2-imino-3-methylimidazol-1-yl]propan-2-ol.
| Compound Name | 1-amino-3-[4-[4-[2-[(E)-1-(2-amino-1,3-thiazol-4-yl)ethylideneamino]oxyethoxy]phenyl]-2-imino-3-methylimidazol-1-yl]propan-2-ol |
|---|---|
| PubChem CID | 166829572 |
| Molecular Formula | C20H27N7O3S |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | 1-amino-3-[4-[4-[2-[(E)-1-(2-amino-1,3-thiazol-4-yl)ethylideneamino]oxyethoxy]phenyl]-2-imino-3-methylimidazol-1-yl]propan-2-ol |
| SMILES | [H]/N=c1\n(CC(O)CN)cc(-c2ccc(OCCO/N=C(\C)c3csc(N)n3)cc2)n1C |
| InChI | InChI=1S/C20H27N7O3S/c1-13(17-12-31-19(22)24-17)25-30-8-7-29-16-5-3-14(4-6-16)18-11-27(10-15(28)9-21)20(23)26(18)2/h3-6,11-12,15,23,28H,7-10,21H2,1-2H3,(H2,22,24)/b23-20-,25-13+ |
| InChIKey | UZZSCCHKJMYTFU-YIYNJLASSA-N |
| XLogP | 1.15 |
| TPSA | 149.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|