C16H13N4O6PS — CID 166829906
[3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate (PubChem CID 166829906) has the molecular formula C16H13N4O6PS and a molecular weight of 420.34 g/mol. Its IUPAC name is [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166829906 |
| Molecular Formula | C16H13N4O6PS |
| Molecular Weight | 420.34 g/mol |
| Exact Mass | 420.03 |
| IUPAC Name | [3-[4-(5-methyl-1,2,4-oxadiazol-3-yl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
| SMILES | Cc1nc(-c2csc(C(=O)c3cn(COP(=O)(O)O)c4ccccc34)n2)no1 |
| InChI | InChI=1S/C16H13N4O6PS/c1-9-17-15(19-26-9)12-7-28-16(18-12)14(21)11-6-20(8-25-27(22,23)24)13-5-3-2-4-10(11)13/h2-7H,8H2,1H3,(H2,22,23,24) |
| InChIKey | VKRDVVABILINSJ-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 140.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.34 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|