C15H10F3N2O6PS — CID 166829919
[3-[4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate (PubChem CID 166829919) has the molecular formula C15H10F3N2O6PS and a molecular weight of 434.29 g/mol. Its IUPAC name is [3-[4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate.
| Compound Name | [3-[4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 166829919 |
| Molecular Formula | C15H10F3N2O6PS |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.99 |
| IUPAC Name | [3-[4-(2,2,2-trifluoroacetyl)-1,3-thiazole-2-carbonyl]indol-1-yl]methyl dihydrogen phosphate |
| SMILES | O=C(c1nc(C(=O)C(F)(F)F)cs1)c1cn(COP(=O)(O)O)c2ccccc12 |
| InChI | InChI=1S/C15H10F3N2O6PS/c16-15(17,18)13(22)10-6-28-14(19-10)12(21)9-5-20(7-26-27(23,24)25)11-4-2-1-3-8(9)11/h1-6H,7H2,(H2,23,24,25) |
| InChIKey | FOYZRXSJVVWMIK-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|