C17H28N4O4 — CID 166830126
(2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,N,3-trimethylbutanamide (PubChem CID 166830126) has the molecular formula C17H28N4O4 and a molecular weight of 352.44 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,N,3-trimethylbutanamide.
| Compound Name | (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,N,3-trimethylbutanamide |
|---|---|
| PubChem CID | 166830126 |
| Molecular Formula | C17H28N4O4 |
| Molecular Weight | 352.44 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | (2S)-2-[[(2S)-2-[(2,5-dioxopyrrol-1-yl)-methylamino]-3-methylbutanoyl]amino]-N,N,3-trimethylbutanamide |
| SMILES | CC(C)[C@H](NC(=O)[C@H](C(C)C)N(C)N1C(=O)C=CC1=O)C(=O)N(C)C |
| InChI | InChI=1S/C17H28N4O4/c1-10(2)14(17(25)19(5)6)18-16(24)15(11(3)4)20(7)21-12(22)8-9-13(21)23/h8-11,14-15H,1-7H3,(H,18,24)/t14-,15-/m0/s1 |
| InChIKey | UYNYXWMBSCGUEN-GJZGRUSLSA-N |
| XLogP | 0.01 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.44 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|