C12H20N2 — CID 166830865
3-ethyl-5-methyl-3,4,6,7,8,9-hexahydro-2H-pyrido[4,3-b]azepine (PubChem CID 166830865) has the molecular formula C12H20N2 and a molecular weight of 192.31 g/mol. Its IUPAC name is 3-ethyl-5-methyl-3,4,6,7,8,9-hexahydro-2H-pyrido[4,3-b]azepine.
| Compound Name | 3-ethyl-5-methyl-3,4,6,7,8,9-hexahydro-2H-pyrido[4,3-b]azepine |
|---|---|
| PubChem CID | 166830865 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 3-ethyl-5-methyl-3,4,6,7,8,9-hexahydro-2H-pyrido[4,3-b]azepine |
| SMILES | CCC1CN=C2CCNCC2=C(C)C1 |
| InChI | InChI=1S/C12H20N2/c1-3-10-6-9(2)11-8-13-5-4-12(11)14-7-10/h10,13H,3-8H2,1-2H3 |
| InChIKey | BQZLBGWOSYXWCU-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |