About 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid
6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid (PubChem CID 166831391) has the molecular formula C11H9BrN2O3
and a molecular weight of 297.11 g/mol. Its IUPAC name is 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid.
Molecular Properties
| Compound Name | 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid |
| PubChem CID | 166831391 |
| Molecular Formula | C11H9BrN2O3 |
| Molecular Weight | 297.11 g/mol |
| Exact Mass | 295.98 |
| IUPAC Name | 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid |
| SMILES | CCn1c(=O)c(C(=O)O)cc2cc(Br)cnc21 |
| InChI | InChI=1S/C11H9BrN2O3/c1-2-14-9-6(3-7(12)5-13-9)4-8(10(14)15)11(16)17/h3-5H,2H2,1H3,(H,16,17) |
| InChIKey | CCONSLZSCZVFHA-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.11 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid?
The IUPAC name of 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid (CID 166831391) is 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid.
What is the SMILES notation for 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid?
The canonical SMILES for 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid is CCn1c(=O)c(C(=O)O)cc2cc(Br)cnc21.
What is the InChIKey of 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid?
The InChIKey is CCONSLZSCZVFHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H9BrN2O3/c1-2-14-9-6(3-7(12)5-13-9)4-8(10(14)15)11(16)17/h3-5H,2H2,1H3,(H,16,17).
What are the key properties of 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid?
6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid has a molecular weight of 297.11 g/mol, XLogP of 1.88, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1-ethyl-2-oxo-1,8-naphthyridine-3-carboxylic acid is sourced from PubChem (CID 166831391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).