C24H36O6 — CID 166831628
(1R,5S,10S,14R,16R,17S,18R,21S)-13-(hydroxymethyl)-5-methyl-8-propan-2-yl-15,20,22-trioxapentacyclo[12.8.0.02,10.05,9.016,21]docosa-8,12-diene-17,18-diol (PubChem CID 166831628) has the molecular formula C24H36O6 and a molecular weight of 420.55 g/mol. Its IUPAC name is (1R,5S,10S,14R,16R,17S,18R,21S)-13-(hydroxymethyl)-5-methyl-8-propan-2-yl-15,20,22-trioxapentacyclo[12.8.0.02,10.05,9.016,21]docosa-8,12-diene-17,18-diol.
| Compound Name | (1R,5S,10S,14R,16R,17S,18R,21S)-13-(hydroxymethyl)-5-methyl-8-propan-2-yl-15,20,22-trioxapentacyclo[12.8.0.02,10.05,9.016,21]docosa-8,12-diene-17,18-diol |
|---|---|
| PubChem CID | 166831628 |
| Molecular Formula | C24H36O6 |
| Molecular Weight | 420.55 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | (1R,5S,10S,14R,16R,17S,18R,21S)-13-(hydroxymethyl)-5-methyl-8-propan-2-yl-15,20,22-trioxapentacyclo[12.8.0.02,10.05,9.016,21]docosa-8,12-diene-17,18-diol |
| SMILES | CC(C)C1=C2[C@H]3CC=C(CO)[C@H]4O[C@H]5[C@@H](OC[C@@H](O)[C@@H]5O)O[C@@H]4C3CC[C@@]2(C)CC1 |
| InChI | InChI=1S/C24H36O6/c1-12(2)14-6-8-24(3)9-7-16-15(18(14)24)5-4-13(10-25)20-21(16)30-23-22(29-20)19(27)17(26)11-28-23/h4,12,15-17,19-23,25-27H,5-11H2,1-3H3/t15-,16?,17+,19-,20+,21+,22+,23-,24+/m0/s1 |
| InChIKey | LTNJVMZJBGPNMO-RLVKHCDVSA-N |
| XLogP | 2.32 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.55 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|