C15H31NO3Sn — CID 16683176
4-[(2,2-dibutyl-1,3,2-dioxastannolan-4-yl)methyl]morpholine (PubChem CID 16683176) has the molecular formula C15H31NO3Sn and a molecular weight of 392.13 g/mol. Its IUPAC name is 4-[(2,2-dibutyl-1,3,2-dioxastannolan-4-yl)methyl]morpholine.
| Compound Name | 4-[(2,2-dibutyl-1,3,2-dioxastannolan-4-yl)methyl]morpholine |
|---|---|
| PubChem CID | 16683176 |
| Molecular Formula | C15H31NO3Sn |
| Molecular Weight | 392.13 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 4-[(2,2-dibutyl-1,3,2-dioxastannolan-4-yl)methyl]morpholine |
| SMILES | CCCC[Sn]1(CCCC)OCC(CN2CCOCC2)O1 |
| InChI | InChI=1S/C7H13NO3.2C4H9.Sn/c9-6-7(10)5-8-1-3-11-4-2-8;2*1-3-4-2;/h7H,1-6H2;2*1,3-4H2,2H3;/q-2;;;+2 |
| InChIKey | ZGBONOUZBPJZFF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |