C16H26N6O2 — CID 166831802
2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]phenyl]-N-(2-hydrazinylethyl)acetamide (PubChem CID 166831802) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]phenyl]-N-(2-hydrazinylethyl)acetamide.
| Compound Name | 2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]phenyl]-N-(2-hydrazinylethyl)acetamide |
|---|---|
| PubChem CID | 166831802 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 2-[4-[4-(2-amino-2-oxoethyl)piperazin-1-yl]phenyl]-N-(2-hydrazinylethyl)acetamide |
| SMILES | NNCCNC(=O)Cc1ccc(N2CCN(CC(N)=O)CC2)cc1 |
| InChI | InChI=1S/C16H26N6O2/c17-15(23)12-21-7-9-22(10-8-21)14-3-1-13(2-4-14)11-16(24)19-5-6-20-18/h1-4,20H,5-12,18H2,(H2,17,23)(H,19,24) |
| InChIKey | QPBINDWAHALESV-UHFFFAOYSA-N |
| XLogP | -1.58 |
| TPSA | 116.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|