C23H28N4O6 — CID 166831880
2-[2-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]acetic acid (PubChem CID 166831880) has the molecular formula C23H28N4O6 and a molecular weight of 456.50 g/mol. Its IUPAC name is 2-[2-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]acetic acid.
| Compound Name | 2-[2-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]acetic acid |
|---|---|
| PubChem CID | 166831880 |
| Molecular Formula | C23H28N4O6 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 2-[2-[4-[(2,6-dioxopiperidin-3-yl)-methylcarbamoyl]-3-formylphenyl]-2,7-diazaspiro[3.5]nonan-7-yl]acetic acid |
| SMILES | CN(C(=O)c1ccc(N2CC3(CCN(CC(=O)O)CC3)C2)cc1C=O)C1CCC(=O)NC1=O |
| InChI | InChI=1S/C23H28N4O6/c1-25(18-4-5-19(29)24-21(18)32)22(33)17-3-2-16(10-15(17)12-28)27-13-23(14-27)6-8-26(9-7-23)11-20(30)31/h2-3,10,12,18H,4-9,11,13-14H2,1H3,(H,30,31)(H,24,29,32) |
| InChIKey | CXTBQLXAWFFYHU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|