About [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate
[[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate (PubChem CID 16683196) has the molecular formula C22H26F4O5Sn2
and a molecular weight of 683.86 g/mol. Its IUPAC name is [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate.
Molecular Properties
| Compound Name | [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate |
| PubChem CID | 16683196 |
| Molecular Formula | C22H26F4O5Sn2 |
| Molecular Weight | 683.86 g/mol |
| Exact Mass | 685.98 |
| IUPAC Name | [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate |
| SMILES | CC[Sn](CC)(OC(=O)c1c(F)cccc1F)O[Sn](CC)(CC)OC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/2C7H4F2O2.4C2H5.O.2Sn/c2*8-4-2-1-3-5(9)6(4)7(10)11;4*1-2;;;/h2*1-3H,(H,10,11);4*1H2,2H3;;;/q;;;;;;;2*+1/p-2 |
| InChIKey | JZGXIXXBIRSRTK-UHFFFAOYSA-L |
| XLogP | 6.24 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 683.86 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate?
The IUPAC name of [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate (CID 16683196) is [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate.
What is the SMILES notation for [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate?
The canonical SMILES for [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate is CC[Sn](CC)(OC(=O)c1c(F)cccc1F)O[Sn](CC)(CC)OC(=O)c1c(F)cccc1F.
What is the InChIKey of [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate?
The InChIKey is JZGXIXXBIRSRTK-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H4F2O2.4C2H5.O.2Sn/c2*8-4-2-1-3-5(9)6(4)7(10)11;4*1-2;;;/h2*1-3H,(H,10,11);4*1H2,2H3;;;/q;;;;;;;2*+1/p-2.
What are the key properties of [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate?
[[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate has a molecular weight of 683.86 g/mol, XLogP of 6.24, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [[(2,6-difluorobenzoyl)oxy-diethylstannyl]oxy-diethylstannyl] 2,6-difluorobenzoate is sourced from PubChem (CID 16683196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).