About [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate
[dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate (PubChem CID 16683197) has the molecular formula C30H42F4O5Sn2
and a molecular weight of 796.07 g/mol. Its IUPAC name is [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate.
Molecular Properties
| Compound Name | [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate |
| PubChem CID | 16683197 |
| Molecular Formula | C30H42F4O5Sn2 |
| Molecular Weight | 796.07 g/mol |
| Exact Mass | 798.10 |
| IUPAC Name | [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate |
| SMILES | CCCC[Sn](CCCC)(OC(=O)c1cccc(F)c1F)O[Sn](CCCC)(CCCC)OC(=O)c1cccc(F)c1F |
| InChI | InChI=1S/2C7H4F2O2.4C4H9.O.2Sn/c2*8-5-3-1-2-4(6(5)9)7(10)11;4*1-3-4-2;;;/h2*1-3H,(H,10,11);4*1,3-4H2,2H3;;;/q;;;;;;;2*+1/p-2 |
| InChIKey | FCPQKTGLJQPTDZ-UHFFFAOYSA-L |
| XLogP | 9.36 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 796.07 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate?
The IUPAC name of [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate (CID 16683197) is [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate.
What is the SMILES notation for [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate?
The canonical SMILES for [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate is CCCC[Sn](CCCC)(OC(=O)c1cccc(F)c1F)O[Sn](CCCC)(CCCC)OC(=O)c1cccc(F)c1F.
What is the InChIKey of [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate?
The InChIKey is FCPQKTGLJQPTDZ-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H4F2O2.4C4H9.O.2Sn/c2*8-5-3-1-2-4(6(5)9)7(10)11;4*1-3-4-2;;;/h2*1-3H,(H,10,11);4*1,3-4H2,2H3;;;/q;;;;;;;2*+1/p-2.
What are the key properties of [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate?
[dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate has a molecular weight of 796.07 g/mol, XLogP of 9.36, 18 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [dibutyl-[dibutyl-(2,3-difluorobenzoyl)oxystannyl]oxystannyl] 2,3-difluorobenzoate is sourced from PubChem (CID 16683197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).