About (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one
(Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one (PubChem CID 16683210) has the molecular formula C33H26O2Pb
and a molecular weight of 661.77 g/mol. Its IUPAC name is (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one.
Molecular Properties
| Compound Name | (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one |
| PubChem CID | 16683210 |
| Molecular Formula | C33H26O2Pb |
| Molecular Weight | 661.77 g/mol |
| Exact Mass | 662.17 |
| IUPAC Name | (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one |
| SMILES | O=C(/C=C(\O[Pb](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H12O2.3C6H5.Pb/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;3*1-2-4-6-5-3-1;/h1-11,16H;3*1-5H;/q;;;;+1/p-1/b14-11-;;;; |
| InChIKey | FENYMSNLGWHJKX-VDOWVRHSSA-M |
| XLogP | 5.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 661.77 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one?
The IUPAC name of (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one (CID 16683210) is (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one.
What is the SMILES notation for (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one?
The canonical SMILES for (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one is O=C(/C=C(\O[Pb](c1ccccc1)(c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1.
What is the InChIKey of (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one?
The InChIKey is FENYMSNLGWHJKX-VDOWVRHSSA-M. The full InChI is InChI=1S/C15H12O2.3C6H5.Pb/c16-14(12-7-3-1-4-8-12)11-15(17)13-9-5-2-6-10-13;3*1-2-4-6-5-3-1;/h1-11,16H;3*1-5H;/q;;;;+1/p-1/b14-11-;;;;.
What are the key properties of (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one?
(Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one has a molecular weight of 661.77 g/mol, XLogP of 5.59, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-1,3-diphenyl-3-triphenylplumbyloxyprop-2-en-1-one is sourced from PubChem (CID 16683210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).