About 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide
2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide (PubChem CID 166832268) has the molecular formula C14H18INO4
and a molecular weight of 391.21 g/mol. Its IUPAC name is 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide.
Molecular Properties
| Compound Name | 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide |
| PubChem CID | 166832268 |
| Molecular Formula | C14H18INO4 |
| Molecular Weight | 391.21 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide |
| SMILES | O=C(I)CC1CCC/C=C\C(ON2C(=O)CCC2=O)C1 |
| InChI | InChI=1S/C14H18INO4/c15-12(17)9-10-4-2-1-3-5-11(8-10)20-16-13(18)6-7-14(16)19/h3,5,10-11H,1-2,4,6-9H2/b5-3- |
| InChIKey | AGPIAGUKFRXTNK-HYXAFXHYSA-N |
| XLogP | 2.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.21 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide?
The IUPAC name of 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide (CID 166832268) is 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide.
What is the SMILES notation for 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide?
The canonical SMILES for 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide is O=C(I)CC1CCC/C=C\C(ON2C(=O)CCC2=O)C1.
What is the InChIKey of 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide?
The InChIKey is AGPIAGUKFRXTNK-HYXAFXHYSA-N. The full InChI is InChI=1S/C14H18INO4/c15-12(17)9-10-4-2-1-3-5-11(8-10)20-16-13(18)6-7-14(16)19/h3,5,10-11H,1-2,4,6-9H2/b5-3-.
What are the key properties of 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide?
2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide has a molecular weight of 391.21 g/mol, XLogP of 2.53, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4E)-3-(2,5-dioxopyrrolidin-1-yl)oxycyclooct-4-en-1-yl]acetyl iodide is sourced from PubChem (CID 166832268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).